C13H22OSi — CID 102387711
trimethyl-[(1R,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]silane (PubChem CID 102387711) has the molecular formula C13H22OSi and a molecular weight of 222.40 g/mol. Its IUPAC name is trimethyl-[(1R,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]silane.
| Compound Name | trimethyl-[(1R,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]silane |
|---|---|
| PubChem CID | 102387711 |
| Molecular Formula | C13H22OSi |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | trimethyl-[(1R,4S,6R)-1-methyl-4-prop-1-en-2-yl-7-oxabicyclo[4.1.0]hept-2-en-2-yl]silane |
| SMILES | C=C(C)[C@@H]1C=C([Si](C)(C)C)[C@]2(C)O[C@@H]2C1 |
| InChI | InChI=1S/C13H22OSi/c1-9(2)10-7-11-13(3,14-11)12(8-10)15(4,5)6/h8,10-11H,1,7H2,2-6H3/t10-,11+,13+/m0/s1 |
| InChIKey | KCNFXYVYLVKGPA-DMDPSCGWSA-N |
| XLogP | 3.54 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|