C10H14O — CID 59076513
(5S,6S)-3-methyl-5-prop-2-enyl-7-oxabicyclo[4.1.0]hept-2-ene (PubChem CID 59076513) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (5S,6S)-3-methyl-5-prop-2-enyl-7-oxabicyclo[4.1.0]hept-2-ene.
| Compound Name | (5S,6S)-3-methyl-5-prop-2-enyl-7-oxabicyclo[4.1.0]hept-2-ene |
|---|---|
| PubChem CID | 59076513 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (5S,6S)-3-methyl-5-prop-2-enyl-7-oxabicyclo[4.1.0]hept-2-ene |
| SMILES | C=CC[C@H]1CC(C)=CC2O[C@H]21 |
| InChI | InChI=1S/C10H14O/c1-3-4-8-5-7(2)6-9-10(8)11-9/h3,6,8-10H,1,4-5H2,2H3/t8-,9?,10-/m0/s1 |
| InChIKey | CAINMNWHDAPTCG-SMILAEQMSA-N |
| XLogP | 2.30 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|