C26H24ClN3O4 — CID 10238844
1-[(4R,5S)-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-2-(4-nitrophenyl)-4,5-dihydroimidazol-1-yl]-2-methylpropan-1-one (PubChem CID 10238844) has the molecular formula C26H24ClN3O4 and a molecular weight of 477.95 g/mol. Its IUPAC name is 1-[(4R,5S)-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-2-(4-nitrophenyl)-4,5-dihydroimidazol-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[(4R,5S)-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-2-(4-nitrophenyl)-4,5-dihydroimidazol-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 10238844 |
| Molecular Formula | C26H24ClN3O4 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 1-[(4R,5S)-5-(4-chlorophenyl)-4-(4-methoxyphenyl)-2-(4-nitrophenyl)-4,5-dihydroimidazol-1-yl]-2-methylpropan-1-one |
| SMILES | COc1ccc([C@H]2N=C(c3ccc([N+](=O)[O-])cc3)N(C(=O)C(C)C)[C@H]2c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H24ClN3O4/c1-16(2)26(31)29-24(18-4-10-20(27)11-5-18)23(17-8-14-22(34-3)15-9-17)28-25(29)19-6-12-21(13-7-19)30(32)33/h4-16,23-24H,1-3H3/t23-,24+/m1/s1 |
| InChIKey | HCXZBKOQCHOYIT-RPWUZVMVSA-N |
| XLogP | 5.98 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|