C9H16O3S3 — CID 102389988
ethyl 3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)prop-2-enoate (PubChem CID 102389988) has the molecular formula C9H16O3S3 and a molecular weight of 268.42 g/mol. Its IUPAC name is ethyl 3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)prop-2-enoate.
| Compound Name | ethyl 3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)prop-2-enoate |
|---|---|
| PubChem CID | 102389988 |
| Molecular Formula | C9H16O3S3 |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | ethyl 3,3-bis(methylsulfanyl)-2-(methylsulfinylmethyl)prop-2-enoate |
| SMILES | CCOC(=O)C(CS(C)=O)=C(SC)SC |
| InChI | InChI=1S/C9H16O3S3/c1-5-12-8(10)7(6-15(4)11)9(13-2)14-3/h5-6H2,1-4H3 |
| InChIKey | WPRKRCOMMPOCGT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|