About 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate
1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate (PubChem CID 102390201) has the molecular formula C19H30O4
and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate |
| PubChem CID | 102390201 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate |
| SMILES | C=CCOC(=O)CCC(C)(C#CCCCCCC)C(=O)OCC |
| InChI | InChI=1S/C19H30O4/c1-5-8-9-10-11-12-14-19(4,18(21)22-7-3)15-13-17(20)23-16-6-2/h6H,2,5,7-11,13,15-16H2,1,3-4H3 |
| InChIKey | HPOFQAVBYIGCCH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate?
The IUPAC name of 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate (CID 102390201) is 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate is C=CCOC(=O)CCC(C)(C#CCCCCCC)C(=O)OCC.
What is the InChIKey of 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate?
The InChIKey is HPOFQAVBYIGCCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4/c1-5-8-9-10-11-12-14-19(4,18(21)22-7-3)15-13-17(20)23-16-6-2/h6H,2,5,7-11,13,15-16H2,1,3-4H3.
What are the key properties of 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate?
1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate has a molecular weight of 322.45 g/mol, XLogP of 4.04, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-prop-2-enyl 2-methyl-2-oct-1-ynylpentanedioate is sourced from PubChem (CID 102390201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).