C26H24O3S — CID 102390391
methyl (E,2Z)-2-benzylidene-4-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanylbut-3-enoate (PubChem CID 102390391) has the molecular formula C26H24O3S and a molecular weight of 416.54 g/mol. Its IUPAC name is methyl (E,2Z)-2-benzylidene-4-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanylbut-3-enoate.
| Compound Name | methyl (E,2Z)-2-benzylidene-4-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanylbut-3-enoate |
|---|---|
| PubChem CID | 102390391 |
| Molecular Formula | C26H24O3S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | methyl (E,2Z)-2-benzylidene-4-(4-methoxyphenyl)-3-(4-methylphenyl)sulfanylbut-3-enoate |
| SMILES | COC(=O)C(=C/c1ccccc1)/C(=C\c1ccc(OC)cc1)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C26H24O3S/c1-19-9-15-23(16-10-19)30-25(18-21-11-13-22(28-2)14-12-21)24(26(27)29-3)17-20-7-5-4-6-8-20/h4-18H,1-3H3/b24-17+,25-18+ |
| InChIKey | HLGBXFCHGWAEDN-WZGDJCGDSA-N |
| XLogP | 6.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|