C14H16FN3O5 — CID 102391190
(2S,3R,4R,5R)-5-fluoro-2-[4-(2-methoxyphenyl)triazol-1-yl]oxyoxane-3,4-diol (PubChem CID 102391190) has the molecular formula C14H16FN3O5 and a molecular weight of 325.30 g/mol. Its IUPAC name is (2S,3R,4R,5R)-5-fluoro-2-[4-(2-methoxyphenyl)triazol-1-yl]oxyoxane-3,4-diol.
| Compound Name | (2S,3R,4R,5R)-5-fluoro-2-[4-(2-methoxyphenyl)triazol-1-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 102391190 |
| Molecular Formula | C14H16FN3O5 |
| Molecular Weight | 325.30 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | (2S,3R,4R,5R)-5-fluoro-2-[4-(2-methoxyphenyl)triazol-1-yl]oxyoxane-3,4-diol |
| SMILES | COc1ccccc1-c1cn(O[C@@H]2OC[C@@H](F)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C14H16FN3O5/c1-21-11-5-3-2-4-8(11)10-6-18(17-16-10)23-14-13(20)12(19)9(15)7-22-14/h2-6,9,12-14,19-20H,7H2,1H3/t9-,12+,13-,14+/m1/s1 |
| InChIKey | JKPZQRMIQAKUJE-PCDDKUFXSA-N |
| XLogP | -0.20 |
| TPSA | 98.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.30 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |