C12H18O4 — CID 102391654
(3aS,4R,5R,7aS)-2,2-dimethyl-4-prop-2-enyl-5,7a-dihydro-3aH-1,3-benzodioxole-4,5-diol (PubChem CID 102391654) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is (3aS,4R,5R,7aS)-2,2-dimethyl-4-prop-2-enyl-5,7a-dihydro-3aH-1,3-benzodioxole-4,5-diol.
| Compound Name | (3aS,4R,5R,7aS)-2,2-dimethyl-4-prop-2-enyl-5,7a-dihydro-3aH-1,3-benzodioxole-4,5-diol |
|---|---|
| PubChem CID | 102391654 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | (3aS,4R,5R,7aS)-2,2-dimethyl-4-prop-2-enyl-5,7a-dihydro-3aH-1,3-benzodioxole-4,5-diol |
| SMILES | C=CC[C@@]1(O)[C@H](O)C=C[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C12H18O4/c1-4-7-12(14)9(13)6-5-8-10(12)16-11(2,3)15-8/h4-6,8-10,13-14H,1,7H2,2-3H3/t8-,9+,10-,12+/m0/s1 |
| InChIKey | MZYNGKYINQKMPV-MIZYBKAJSA-N |
| XLogP | 0.74 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|