C12H20O3 — CID 102392639
2-[(E)-4-(1,3-dioxolan-2-yl)but-1-enyl]oxane (PubChem CID 102392639) has the molecular formula C12H20O3 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-[(E)-4-(1,3-dioxolan-2-yl)but-1-enyl]oxane.
| Compound Name | 2-[(E)-4-(1,3-dioxolan-2-yl)but-1-enyl]oxane |
|---|---|
| PubChem CID | 102392639 |
| Molecular Formula | C12H20O3 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | 2-[(E)-4-(1,3-dioxolan-2-yl)but-1-enyl]oxane |
| SMILES | C(=C/C1CCCCO1)\CCC1OCCO1 |
| InChI | InChI=1S/C12H20O3/c1(2-7-12-14-9-10-15-12)5-11-6-3-4-8-13-11/h1,5,11-12H,2-4,6-10H2/b5-1+ |
| InChIKey | IMVFKWLTAHNXHK-ORCRQEGFSA-N |
| XLogP | 2.26 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|