C11H23NO3S — CID 102393430
(3R,5R)-1-tert-butylsulfonyl-5-propan-2-ylpyrrolidin-3-ol (PubChem CID 102393430) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is (3R,5R)-1-tert-butylsulfonyl-5-propan-2-ylpyrrolidin-3-ol.
| Compound Name | (3R,5R)-1-tert-butylsulfonyl-5-propan-2-ylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 102393430 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (3R,5R)-1-tert-butylsulfonyl-5-propan-2-ylpyrrolidin-3-ol |
| SMILES | CC(C)[C@H]1C[C@@H](O)CN1S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-8(2)10-6-9(13)7-12(10)16(14,15)11(3,4)5/h8-10,13H,6-7H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | WRLXPNGEAFTIMH-NXEZZACHSA-N |
| XLogP | 1.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |