C12H18N2O2 — CID 102393918
(3aR,8bS)-2,8,8-trimethyl-3a,4,6,7,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 102393918) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is (3aR,8bS)-2,8,8-trimethyl-3a,4,6,7,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,8bS)-2,8,8-trimethyl-3a,4,6,7,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 102393918 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | (3aR,8bS)-2,8,8-trimethyl-3a,4,6,7,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | CN1C(=O)[C@H]2CN3CCC(C)(C)C3[C@H]2C1=O |
| InChI | InChI=1S/C12H18N2O2/c1-12(2)4-5-14-6-7-8(9(12)14)11(16)13(3)10(7)15/h7-9H,4-6H2,1-3H3/t7-,8-,9?/m0/s1 |
| InChIKey | UJKLOSUNDBUZKE-JVIMKECRSA-N |
| XLogP | 0.33 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|