C25H34BrN7O — CID 10239500
6-bromo-8-cyclopentyl-2-[[5-[4-(diethylamino)butylamino]-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 10239500) has the molecular formula C25H34BrN7O and a molecular weight of 528.50 g/mol. Its IUPAC name is 6-bromo-8-cyclopentyl-2-[[5-[4-(diethylamino)butylamino]-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-bromo-8-cyclopentyl-2-[[5-[4-(diethylamino)butylamino]-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10239500 |
| Molecular Formula | C25H34BrN7O |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 527.20 |
| IUPAC Name | 6-bromo-8-cyclopentyl-2-[[5-[4-(diethylamino)butylamino]-2-pyridinyl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCN(CC)CCCCNc1ccc(Nc2ncc3cc(Br)c(=O)n(C4CCCC4)c3n2)nc1 |
| InChI | InChI=1S/C25H34BrN7O/c1-3-32(4-2)14-8-7-13-27-19-11-12-22(28-17-19)30-25-29-16-18-15-21(26)24(34)33(23(18)31-25)20-9-5-6-10-20/h11-12,15-17,20,27H,3-10,13-14H2,1-2H3,(H,28,29,30,31) |
| InChIKey | WBRDUNWPHZNYIB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|