C16H20F3NO3 — CID 102395287
[(2R)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] benzoate (PubChem CID 102395287) has the molecular formula C16H20F3NO3 and a molecular weight of 331.33 g/mol. Its IUPAC name is [(2R)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] benzoate.
| Compound Name | [(2R)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] benzoate |
|---|---|
| PubChem CID | 102395287 |
| Molecular Formula | C16H20F3NO3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [(2R)-2-(tert-butylcarbamoyl)-1,1,1-trifluorobutan-2-yl] benzoate |
| SMILES | CC[C@@](OC(=O)c1ccccc1)(C(=O)NC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO3/c1-5-15(16(17,18)19,13(22)20-14(2,3)4)23-12(21)11-9-7-6-8-10-11/h6-10H,5H2,1-4H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | KEPROWZEULECEV-OAHLLOKOSA-N |
| XLogP | 3.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |