C21H23NO3 — CID 102395525
tert-butyl (4R)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 102395525) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl (4R)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate.
| Compound Name | tert-butyl (4R)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102395525 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl (4R)-4-benzyl-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]1(Cc2ccccc2)COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C21H23NO3/c1-20(2,3)25-19(23)21(14-16-10-6-4-7-11-16)15-24-18(22-21)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3/t21-/m1/s1 |
| InChIKey | NNRIEIUNXLMRGW-OAQYLSRUSA-N |
| XLogP | 3.79 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |