C27H26ClFN6O2S — CID 10239742
5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]methyl]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 10239742) has the molecular formula C27H26ClFN6O2S and a molecular weight of 553.06 g/mol. Its IUPAC name is 5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]methyl]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | 5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]methyl]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10239742 |
| Molecular Formula | C27H26ClFN6O2S |
| Molecular Weight | 553.06 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 5-chloro-6-[[(12-fluoro-5-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-yl)carbamothioylamino]methyl]-N-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | CN1CC[C@@H](NC(=O)c2cnc(CNC(=S)NC3c4cnccc4CCc4c(F)cccc43)c(Cl)c2)C1=O |
| InChI | InChI=1S/C27H26ClFN6O2S/c1-35-10-8-22(26(35)37)33-25(36)16-11-20(28)23(31-12-16)14-32-27(38)34-24-18-3-2-4-21(29)17(18)6-5-15-7-9-30-13-19(15)24/h2-4,7,9,11-13,22,24H,5-6,8,10,14H2,1H3,(H,33,36)(H2,32,34,38)/t22-,24?/m1/s1 |
| InChIKey | MEWJAZGZWPWWQV-LETIRJCYSA-N |
| XLogP | 3.08 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.06 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|