C12H17Br2ClO2 — CID 102397994
[(1R,2Z,3R,5S)-5-bromo-2-(2-bromoethylidene)-3-chloro-4,4-dimethylcyclohexyl] acetate (PubChem CID 102397994) has the molecular formula C12H17Br2ClO2 and a molecular weight of 388.53 g/mol. Its IUPAC name is [(1R,2Z,3R,5S)-5-bromo-2-(2-bromoethylidene)-3-chloro-4,4-dimethylcyclohexyl] acetate.
| Compound Name | [(1R,2Z,3R,5S)-5-bromo-2-(2-bromoethylidene)-3-chloro-4,4-dimethylcyclohexyl] acetate |
|---|---|
| PubChem CID | 102397994 |
| Molecular Formula | C12H17Br2ClO2 |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 385.93 |
| IUPAC Name | [(1R,2Z,3R,5S)-5-bromo-2-(2-bromoethylidene)-3-chloro-4,4-dimethylcyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H](Br)C(C)(C)[C@H](Cl)/C1=C\CBr |
| InChI | InChI=1S/C12H17Br2ClO2/c1-7(16)17-9-6-10(14)12(2,3)11(15)8(9)4-5-13/h4,9-11H,5-6H2,1-3H3/b8-4-/t9-,10+,11-/m1/s1 |
| InChIKey | BURJCSPPDZTXBA-POQBUDAHSA-N |
| XLogP | 4.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|