C10H14BrClO — CID 23426907
4-bromo-6-chloro-5,5-dimethyl-4,6,7,7a-tetrahydro-2H-1-benzofuran (PubChem CID 23426907) has the molecular formula C10H14BrClO and a molecular weight of 265.58 g/mol. Its IUPAC name is 4-bromo-6-chloro-5,5-dimethyl-4,6,7,7a-tetrahydro-2H-1-benzofuran.
| Compound Name | 4-bromo-6-chloro-5,5-dimethyl-4,6,7,7a-tetrahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 23426907 |
| Molecular Formula | C10H14BrClO |
| Molecular Weight | 265.58 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | 4-bromo-6-chloro-5,5-dimethyl-4,6,7,7a-tetrahydro-2H-1-benzofuran |
| SMILES | CC1(C)C(Cl)CC2OCC=C2C1Br |
| InChI | InChI=1S/C10H14BrClO/c1-10(2)8(12)5-7-6(9(10)11)3-4-13-7/h3,7-9H,4-5H2,1-2H3 |
| InChIKey | VYPLPQJIJPJWGU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|