About pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate
pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate (PubChem CID 102398752) has the molecular formula C27H22N4O2
and a molecular weight of 434.50 g/mol. Its IUPAC name is pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate.
Molecular Properties
| Compound Name | pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate |
| PubChem CID | 102398752 |
| Molecular Formula | C27H22N4O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate |
| SMILES | C[C@@H](NC[C@H](N=[N+]=[N-])C(=O)Oc1ccc2ccc3cccc4ccc1c2c34)c1ccccc1 |
| InChI | InChI=1S/C27H22N4O2/c1-17(18-6-3-2-4-7-18)29-16-23(30-31-28)27(32)33-24-15-13-21-11-10-19-8-5-9-20-12-14-22(24)26(21)25(19)20/h2-15,17,23,29H,16H2,1H3/t17-,23+/m1/s1 |
| InChIKey | PVSVNQMLQGGFNG-HXOBKFHXSA-N |
| XLogP | 6.52 |
| TPSA | 87.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate?
The IUPAC name of pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate (CID 102398752) is pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate.
What is the SMILES notation for pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate?
The canonical SMILES for pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate is C[C@@H](NC[C@H](N=[N+]=[N-])C(=O)Oc1ccc2ccc3cccc4ccc1c2c34)c1ccccc1.
What is the InChIKey of pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate?
The InChIKey is PVSVNQMLQGGFNG-HXOBKFHXSA-N. The full InChI is InChI=1S/C27H22N4O2/c1-17(18-6-3-2-4-7-18)29-16-23(30-31-28)27(32)33-24-15-13-21-11-10-19-8-5-9-20-12-14-22(24)26(21)25(19)20/h2-15,17,23,29H,16H2,1H3/t17-,23+/m1/s1.
What are the key properties of pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate?
pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate has a molecular weight of 434.50 g/mol, XLogP of 6.52, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyren-1-yl (2S)-2-azido-3-[[(1R)-1-phenylethyl]amino]propanoate is sourced from PubChem (CID 102398752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).