C10H10ClIN2S — CID 1023989
(5S)-N-(4-chlorophenyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 1023989) has the molecular formula C10H10ClIN2S and a molecular weight of 352.63 g/mol. Its IUPAC name is (5S)-N-(4-chlorophenyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | (5S)-N-(4-chlorophenyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 1023989 |
| Molecular Formula | C10H10ClIN2S |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | (5S)-N-(4-chlorophenyl)-5-(iodomethyl)-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | Clc1ccc(NC2=NC[C@@H](CI)S2)cc1 |
| InChI | InChI=1S/C10H10ClIN2S/c11-7-1-3-8(4-2-7)14-10-13-6-9(5-12)15-10/h1-4,9H,5-6H2,(H,13,14)/t9-/m1/s1 |
| InChIKey | KSURQIDBPNDRGH-SECBINFHSA-N |
| XLogP | 3.66 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|