C14H19IN2S — CID 106284701
N-(4-iodophenyl)-5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 106284701) has the molecular formula C14H19IN2S and a molecular weight of 374.29 g/mol. Its IUPAC name is N-(4-iodophenyl)-5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine.
| Compound Name | N-(4-iodophenyl)-5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 106284701 |
| Molecular Formula | C14H19IN2S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-(4-iodophenyl)-5-pentan-3-yl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCC(CC)C1CN=C(Nc2ccc(I)cc2)S1 |
| InChI | InChI=1S/C14H19IN2S/c1-3-10(4-2)13-9-16-14(18-13)17-12-7-5-11(15)6-8-12/h5-8,10,13H,3-4,9H2,1-2H3,(H,16,17) |
| InChIKey | KJOPJCUFMLGJDE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|