C23H39NO3Si — CID 102399529
[(6Z)-11-[tert-butyl(dimethyl)silyl]oxy-12-cyano-5-methylidenetrideca-6,12-dien-4-yl] acetate (PubChem CID 102399529) has the molecular formula C23H39NO3Si and a molecular weight of 405.66 g/mol. Its IUPAC name is [(6Z)-11-[tert-butyl(dimethyl)silyl]oxy-12-cyano-5-methylidenetrideca-6,12-dien-4-yl] acetate.
| Compound Name | [(6Z)-11-[tert-butyl(dimethyl)silyl]oxy-12-cyano-5-methylidenetrideca-6,12-dien-4-yl] acetate |
|---|---|
| PubChem CID | 102399529 |
| Molecular Formula | C23H39NO3Si |
| Molecular Weight | 405.66 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | [(6Z)-11-[tert-butyl(dimethyl)silyl]oxy-12-cyano-5-methylidenetrideca-6,12-dien-4-yl] acetate |
| SMILES | C=C(C#N)C(CCC/C=C\C(=C)C(CCC)OC(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO3Si/c1-10-14-21(26-20(4)25)18(2)15-12-11-13-16-22(19(3)17-24)27-28(8,9)23(5,6)7/h12,15,21-22H,2-3,10-11,13-14,16H2,1,4-9H3/b15-12- |
| InChIKey | FHOVNCVWZDZGNM-QINSGFPZSA-N |
| XLogP | 6.47 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|