C19H32O3Si — CID 134865991
[(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylnon-8-en-1-yn-3-yl] prop-2-enoate (PubChem CID 134865991) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylnon-8-en-1-yn-3-yl] prop-2-enoate.
| Compound Name | [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylnon-8-en-1-yn-3-yl] prop-2-enoate |
|---|---|
| PubChem CID | 134865991 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | [(3S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methylnon-8-en-1-yn-3-yl] prop-2-enoate |
| SMILES | C#C[C@](C)(OC(=O)C=C)[C@@H](CCCC=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O3Si/c1-10-13-14-15-16(22-23(8,9)18(4,5)6)19(7,12-3)21-17(20)11-2/h3,10-11,16H,1-2,13-15H2,4-9H3/t16-,19+/m1/s1 |
| InChIKey | KLYGRRFUQURDNN-APWZRJJASA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|