C23H40O4Si — CID 101154486
(3R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oct-7-en-1-yn-3-ol (PubChem CID 101154486) has the molecular formula C23H40O4Si and a molecular weight of 408.66 g/mol. Its IUPAC name is (3R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oct-7-en-1-yn-3-ol.
| Compound Name | (3R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oct-7-en-1-yn-3-ol |
|---|---|
| PubChem CID | 101154486 |
| Molecular Formula | C23H40O4Si |
| Molecular Weight | 408.66 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (3R)-3-[(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]oct-7-en-1-yn-3-ol |
| SMILES | C#C[C@@](O)(CCCC=C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C23H40O4Si/c1-11-14-15-16-23(24,13-3)17-19(27-28(9,10)21(4,5)6)20-18(12-2)25-22(7,8)26-20/h3,11-12,18-20,24H,1-2,14-17H2,4-10H3/t18-,19+,20-,23-/m1/s1 |
| InChIKey | SFMDASIIYOPJJG-VLVHOKLOSA-N |
| XLogP | 5.19 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.66 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|