C21H38O5Si — CID 11211698
[(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11211698) has the molecular formula C21H38O5Si and a molecular weight of 398.62 g/mol. Its IUPAC name is [(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11211698 |
| Molecular Formula | C21H38O5Si |
| Molecular Weight | 398.62 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | [(1S)-1-[(3aR,5S,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pent-4-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCC=C |
| InChI | InChI=1S/C21H38O5Si/c1-10-12-13-15(26-27(8,9)20(3,4)5)16-17(22-14-11-2)18-19(23-16)25-21(6,7)24-18/h10-11,15-19H,1-2,12-14H2,3-9H3/t15-,16+,17-,18+,19+/m0/s1 |
| InChIKey | OPWGXZNSUDPBAS-ZWJWXYIHSA-N |
| XLogP | 4.79 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.62 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|