C24H33F2O8P — CID 100951850
[(4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-difluoro-4-prop-2-enoxybutyl]-phenylmethoxyphosphinic acid (PubChem CID 100951850) has the molecular formula C24H33F2O8P and a molecular weight of 518.49 g/mol. Its IUPAC name is [(4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-difluoro-4-prop-2-enoxybutyl]-phenylmethoxyphosphinic acid.
| Compound Name | [(4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-difluoro-4-prop-2-enoxybutyl]-phenylmethoxyphosphinic acid |
|---|---|
| PubChem CID | 100951850 |
| Molecular Formula | C24H33F2O8P |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | [(4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-prop-2-enoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,1-difluoro-4-prop-2-enoxybutyl]-phenylmethoxyphosphinic acid |
| SMILES | C=CCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H](CCC(F)(F)P(=O)(O)OCc1ccccc1)OCC=C |
| InChI | InChI=1S/C24H33F2O8P/c1-5-14-29-18(19-20(30-15-6-2)21-22(32-19)34-23(3,4)33-21)12-13-24(25,26)35(27,28)31-16-17-10-8-7-9-11-17/h5-11,18-22H,1-2,12-16H2,3-4H3,(H,27,28)/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | MONGMRPJIPWUAG-QMCAAQAGSA-N |
| XLogP | 4.78 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|