C16H26O6 — CID 22858641
(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(1S)-1-prop-2-enoxyethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane (PubChem CID 22858641) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(1S)-1-prop-2-enoxyethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane.
| Compound Name | (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(1S)-1-prop-2-enoxyethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
|---|---|
| PubChem CID | 22858641 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-8-[(1S)-1-prop-2-enoxyethyl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane |
| SMILES | C=CCO[C@@H](C)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C16H26O6/c1-7-8-17-9(2)10-11-12(20-15(3,4)19-11)13-14(18-10)22-16(5,6)21-13/h7,9-14H,1,8H2,2-6H3/t9-,10+,11-,12-,13+,14+/m0/s1 |
| InChIKey | FRUPLCXQSGXOMK-XNBXPENISA-N |
| XLogP | 1.97 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|