C23H45NO4SSi2 — CID 134845885
tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(1S)-1-isothiocyanatoprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane (PubChem CID 134845885) has the molecular formula C23H45NO4SSi2 and a molecular weight of 487.86 g/mol. Its IUPAC name is tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(1S)-1-isothiocyanatoprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(1S)-1-isothiocyanatoprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134845885 |
| Molecular Formula | C23H45NO4SSi2 |
| Molecular Weight | 487.86 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | tert-butyl-[(1R)-2-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[(1S)-1-isothiocyanatoprop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]ethoxy]-dimethylsilane |
| SMILES | C=C[C@H](N=C=S)[C@@H]1OC(C)(C)O[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45NO4SSi2/c1-14-17(24-16-29)19-20(27-23(8,9)26-19)18(28-31(12,13)22(5,6)7)15-25-30(10,11)21(2,3)4/h14,17-20H,1,15H2,2-13H3/t17-,18+,19-,20+/m0/s1 |
| InChIKey | KDORFNQOXUENOG-ZGXWSNOMSA-N |
| XLogP | 6.58 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.86 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|