C19H34O4 — CID 11954720
(2S)-2-[(4R,5R)-5-[(2S)-2-hydroxyhept-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-en-2-ol (PubChem CID 11954720) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2S)-2-[(4R,5R)-5-[(2S)-2-hydroxyhept-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-en-2-ol.
| Compound Name | (2S)-2-[(4R,5R)-5-[(2S)-2-hydroxyhept-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-en-2-ol |
|---|---|
| PubChem CID | 11954720 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (2S)-2-[(4R,5R)-5-[(2S)-2-hydroxyhept-6-en-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]hept-6-en-2-ol |
| SMILES | C=CCCC[C@](C)(O)[C@@H]1OC(C)(C)O[C@H]1[C@@](C)(O)CCCC=C |
| InChI | InChI=1S/C19H34O4/c1-7-9-11-13-18(5,20)15-16(23-17(3,4)22-15)19(6,21)14-12-10-8-2/h7-8,15-16,20-21H,1-2,9-14H2,3-6H3/t15-,16-,18+,19+/m1/s1 |
| InChIKey | LUMHIZLBEQUPKC-FPAYPSAMSA-N |
| XLogP | 3.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|