C12H22O3 — CID 11344917
[(4R,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]methanol (PubChem CID 11344917) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is [(4R,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(4R,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 11344917 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | [(4R,6S)-2,2-dimethyl-6-pent-4-enyl-1,3-dioxan-4-yl]methanol |
| SMILES | C=CCCC[C@H]1C[C@H](CO)OC(C)(C)O1 |
| InChI | InChI=1S/C12H22O3/c1-4-5-6-7-10-8-11(9-13)15-12(2,3)14-10/h4,10-11,13H,1,5-9H2,2-3H3/t10-,11+/m0/s1 |
| InChIKey | VUKJSTBLPUVXDR-WDEREUQCSA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|