C13H22O3 — CID 10704445
[(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]methanol (PubChem CID 10704445) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]methanol.
| Compound Name | [(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 10704445 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [(4S)-2,2-dimethyl-6,6-bis(prop-2-enyl)-1,3-dioxan-4-yl]methanol |
| SMILES | C=CCC1(CC=C)C[C@@H](CO)OC(C)(C)O1 |
| InChI | InChI=1S/C13H22O3/c1-5-7-13(8-6-2)9-11(10-14)15-12(3,4)16-13/h5-6,11,14H,1-2,7-10H2,3-4H3/t11-/m0/s1 |
| InChIKey | NJQUZSGCXFFTSH-NSHDSACASA-N |
| XLogP | 2.41 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|