C23H42N2O6Si — CID 72984168
3-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-N-(2-oxoazepan-3-yl)propanamide (PubChem CID 72984168) has the molecular formula C23H42N2O6Si and a molecular weight of 470.68 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-N-(2-oxoazepan-3-yl)propanamide.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-N-(2-oxoazepan-3-yl)propanamide |
|---|---|
| PubChem CID | 72984168 |
| Molecular Formula | C23H42N2O6Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.28 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-3-(5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl)-2-methoxy-N-(2-oxoazepan-3-yl)propanamide |
| SMILES | C=CC1OC(C)(C)OC1C(O[Si](C)(C)C(C)(C)C)C(OC)C(=O)NC1CCCCNC1=O |
| InChI | InChI=1S/C23H42N2O6Si/c1-10-16-17(30-23(5,6)29-16)18(31-32(8,9)22(2,3)4)19(28-7)21(27)25-15-13-11-12-14-24-20(15)26/h10,15-19H,1,11-14H2,2-9H3,(H,24,26)(H,25,27) |
| InChIKey | JHIBQQSIZDISRZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|