C27H27BO3S — CID 102400666
2-(9-methoxy-8-phenylsulfanylanthracen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102400666) has the molecular formula C27H27BO3S and a molecular weight of 442.39 g/mol. Its IUPAC name is 2-(9-methoxy-8-phenylsulfanylanthracen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(9-methoxy-8-phenylsulfanylanthracen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102400666 |
| Molecular Formula | C27H27BO3S |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-(9-methoxy-8-phenylsulfanylanthracen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | COc1c2c(Sc3ccccc3)cccc2cc2cccc(B3OC(C)(C)C(C)(C)O3)c12 |
| InChI | InChI=1S/C27H27BO3S/c1-26(2)27(3,4)31-28(30-26)21-15-9-11-18-17-19-12-10-16-22(24(19)25(29-5)23(18)21)32-20-13-7-6-8-14-20/h6-17H,1-5H3 |
| InChIKey | VKHVYZZTVZCLFZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|