C23H31BO2S — CID 145280891
4,4,5,5-tetramethyl-2-(3-pentyl-4-phenylsulfanylphenyl)-1,3,2-dioxaborolane (PubChem CID 145280891) has the molecular formula C23H31BO2S and a molecular weight of 382.38 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(3-pentyl-4-phenylsulfanylphenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(3-pentyl-4-phenylsulfanylphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145280891 |
| Molecular Formula | C23H31BO2S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(3-pentyl-4-phenylsulfanylphenyl)-1,3,2-dioxaborolane |
| SMILES | CCCCCc1cc(B2OC(C)(C)C(C)(C)O2)ccc1Sc1ccccc1 |
| InChI | InChI=1S/C23H31BO2S/c1-6-7-9-12-18-17-19(24-25-22(2,3)23(4,5)26-24)15-16-21(18)27-20-13-10-8-11-14-20/h8,10-11,13-17H,6-7,9,12H2,1-5H3 |
| InChIKey | NENNSWSRTMPSEQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|