C21H17F3N2O3 — CID 102401221
1-methyl-5-phenyl-5-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione (PubChem CID 102401221) has the molecular formula C21H17F3N2O3 and a molecular weight of 402.37 g/mol. Its IUPAC name is 1-methyl-5-phenyl-5-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-methyl-5-phenyl-5-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 102401221 |
| Molecular Formula | C21H17F3N2O3 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 1-methyl-5-phenyl-5-prop-2-enyl-3-[4-(trifluoromethyl)phenyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C=CCC1(c2ccccc2)C(=O)N(C)C(=O)N(c2ccc(C(F)(F)F)cc2)C1=O |
| InChI | InChI=1S/C21H17F3N2O3/c1-3-13-20(14-7-5-4-6-8-14)17(27)25(2)19(29)26(18(20)28)16-11-9-15(10-12-16)21(22,23)24/h3-12H,1,13H2,2H3 |
| InChIKey | MNXUGGHDZSYRQV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|