C13H17NO3 — CID 102401333
(3aR,4S,7aS)-5-ethenyl-4-(2-hydroxyethyl)-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 102401333) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (3aR,4S,7aS)-5-ethenyl-4-(2-hydroxyethyl)-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,4S,7aS)-5-ethenyl-4-(2-hydroxyethyl)-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 102401333 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (3aR,4S,7aS)-5-ethenyl-4-(2-hydroxyethyl)-2-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | C=CC1=CC[C@@H]2C(=O)N(C)C(=O)[C@@H]2[C@@H]1CCO |
| InChI | InChI=1S/C13H17NO3/c1-3-8-4-5-10-11(9(8)6-7-15)13(17)14(2)12(10)16/h3-4,9-11,15H,1,5-7H2,2H3/t9-,10+,11-/m1/s1 |
| InChIKey | OYAGMCKECSLHSK-OUAUKWLOSA-N |
| XLogP | 0.73 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|