C13H17NO2 — CID 100983704
(3aR,7S,7aS)-7a-ethynyl-7-(2-hydroxyethyl)-2-methyl-3,3a,4,7-tetrahydroisoindol-1-one (PubChem CID 100983704) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (3aR,7S,7aS)-7a-ethynyl-7-(2-hydroxyethyl)-2-methyl-3,3a,4,7-tetrahydroisoindol-1-one.
| Compound Name | (3aR,7S,7aS)-7a-ethynyl-7-(2-hydroxyethyl)-2-methyl-3,3a,4,7-tetrahydroisoindol-1-one |
|---|---|
| PubChem CID | 100983704 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (3aR,7S,7aS)-7a-ethynyl-7-(2-hydroxyethyl)-2-methyl-3,3a,4,7-tetrahydroisoindol-1-one |
| SMILES | C#C[C@@]12C(=O)N(C)C[C@@H]1CC=C[C@@H]2CCO |
| InChI | InChI=1S/C13H17NO2/c1-3-13-10(7-8-15)5-4-6-11(13)9-14(2)12(13)16/h1,4-5,10-11,15H,6-9H2,2H3/t10-,11+,13+/m1/s1 |
| InChIKey | IVMMCPNMFWYYOC-MDZLAQPJSA-N |
| XLogP | 0.65 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|