C14H16Cl3NO2 — CID 102401528
2,2,2-trichloroethyl N-(3,3-dimethyl-1,2-dihydroinden-1-yl)carbamate (PubChem CID 102401528) has the molecular formula C14H16Cl3NO2 and a molecular weight of 336.65 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(3,3-dimethyl-1,2-dihydroinden-1-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-(3,3-dimethyl-1,2-dihydroinden-1-yl)carbamate |
|---|---|
| PubChem CID | 102401528 |
| Molecular Formula | C14H16Cl3NO2 |
| Molecular Weight | 336.65 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2,2,2-trichloroethyl N-(3,3-dimethyl-1,2-dihydroinden-1-yl)carbamate |
| SMILES | CC1(C)CC(NC(=O)OCC(Cl)(Cl)Cl)c2ccccc21 |
| InChI | InChI=1S/C14H16Cl3NO2/c1-13(2)7-11(9-5-3-4-6-10(9)13)18-12(19)20-8-14(15,16)17/h3-6,11H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | REYKQHCCLLYNED-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|