C16H17N4- — CID 102401866
1-[2,4-dimethyl-5-(3-methylpyrazol-1-yl)benzene-6-id-1-yl]-3-methylpyrazole (PubChem CID 102401866) has the molecular formula C16H17N4- and a molecular weight of 265.34 g/mol. Its IUPAC name is 1-[2,4-dimethyl-5-(3-methylpyrazol-1-yl)benzene-6-id-1-yl]-3-methylpyrazole.
| Compound Name | 1-[2,4-dimethyl-5-(3-methylpyrazol-1-yl)benzene-6-id-1-yl]-3-methylpyrazole |
|---|---|
| PubChem CID | 102401866 |
| Molecular Formula | C16H17N4- |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 1-[2,4-dimethyl-5-(3-methylpyrazol-1-yl)benzene-6-id-1-yl]-3-methylpyrazole |
| SMILES | Cc1ccn(-c2[c-]c(-n3ccc(C)n3)c(C)cc2C)n1 |
| InChI | InChI=1S/C16H17N4/c1-11-9-12(2)16(20-8-6-14(4)18-20)10-15(11)19-7-5-13(3)17-19/h5-9H,1-4H3/q-1 |
| InChIKey | WDCOXVASKWBGBX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|