C9H6Cl3N3 — CID 102752171
2,3,5-trichloro-6-(3-methylpyrazol-1-yl)pyridine (PubChem CID 102752171) has the molecular formula C9H6Cl3N3 and a molecular weight of 262.53 g/mol. Its IUPAC name is 2,3,5-trichloro-6-(3-methylpyrazol-1-yl)pyridine.
| Compound Name | 2,3,5-trichloro-6-(3-methylpyrazol-1-yl)pyridine |
|---|---|
| PubChem CID | 102752171 |
| Molecular Formula | C9H6Cl3N3 |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2,3,5-trichloro-6-(3-methylpyrazol-1-yl)pyridine |
| SMILES | Cc1ccn(-c2nc(Cl)c(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C9H6Cl3N3/c1-5-2-3-15(14-5)9-7(11)4-6(10)8(12)13-9/h2-4H,1H3 |
| InChIKey | RDVSZROAIHLZIV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|