C28H25P — CID 102403237
[(E)-1,2-bis(4-methylphenyl)ethenyl]-diphenylphosphane (PubChem CID 102403237) has the molecular formula C28H25P and a molecular weight of 392.48 g/mol. Its IUPAC name is [(E)-1,2-bis(4-methylphenyl)ethenyl]-diphenylphosphane.
| Compound Name | [(E)-1,2-bis(4-methylphenyl)ethenyl]-diphenylphosphane |
|---|---|
| PubChem CID | 102403237 |
| Molecular Formula | C28H25P |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | [(E)-1,2-bis(4-methylphenyl)ethenyl]-diphenylphosphane |
| SMILES | Cc1ccc(/C=C(\c2ccc(C)cc2)P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25P/c1-22-13-17-24(18-14-22)21-28(25-19-15-23(2)16-20-25)29(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-21H,1-2H3/b28-21+ |
| InChIKey | MVMISGMBHOLEHV-SGWCAAJKSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|