C21H22O3 — CID 102405004
[(3E)-4-(4-phenoxyphenyl)buta-1,3-dien-2-yl] 2,2-dimethylpropanoate (PubChem CID 102405004) has the molecular formula C21H22O3 and a molecular weight of 322.40 g/mol. Its IUPAC name is [(3E)-4-(4-phenoxyphenyl)buta-1,3-dien-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3E)-4-(4-phenoxyphenyl)buta-1,3-dien-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102405004 |
| Molecular Formula | C21H22O3 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | [(3E)-4-(4-phenoxyphenyl)buta-1,3-dien-2-yl] 2,2-dimethylpropanoate |
| SMILES | C=C(/C=C/c1ccc(Oc2ccccc2)cc1)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H22O3/c1-16(23-20(22)21(2,3)4)10-11-17-12-14-19(15-13-17)24-18-8-6-5-7-9-18/h5-15H,1H2,2-4H3/b11-10+ |
| InChIKey | YOXXJLAMMIRZHC-ZHACJKMWSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|