C29H24F26O3 — CID 10240588
1-[(2R,3S,4S)-3-[5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxan-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]ethanone (PubChem CID 10240588) has the molecular formula C29H24F26O3 and a molecular weight of 914.46 g/mol. Its IUPAC name is 1-[(2R,3S,4S)-3-[5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxan-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]ethanone.
| Compound Name | 1-[(2R,3S,4S)-3-[5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxan-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
|---|---|
| PubChem CID | 10240588 |
| Molecular Formula | C29H24F26O3 |
| Molecular Weight | 914.46 g/mol |
| Exact Mass | 914.13 |
| IUPAC Name | 1-[(2R,3S,4S)-3-[5,5-bis(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)-1,3-dioxan-2-yl]-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
| SMILES | CC(=O)[C@@H]1C2C=C[C@H](C2)[C@@H]1C1OCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CO1 |
| InChI | InChI=1S/C29H24F26O3/c1-11(56)14-12-2-3-13(8-12)15(14)16-57-9-17(10-58-16,4-6-18(30,31)20(34,35)22(38,39)24(42,43)26(46,47)28(50,51)52)5-7-19(32,33)21(36,37)23(40,41)25(44,45)27(48,49)29(53,54)55/h2-3,12-16H,4-10H2,1H3/t12?,13-,14-,15+/m1/s1 |
| InChIKey | NXKXPOQAMQBKHR-NUDNTCICSA-N |
| XLogP | 11.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.46 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|