C18H24O7S — CID 102406003
(1R,5R,7R,8R)-3-(benzenesulfinyl)-1-hydroxy-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]decan-4-one (PubChem CID 102406003) has the molecular formula C18H24O7S and a molecular weight of 384.45 g/mol. Its IUPAC name is (1R,5R,7R,8R)-3-(benzenesulfinyl)-1-hydroxy-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]decan-4-one.
| Compound Name | (1R,5R,7R,8R)-3-(benzenesulfinyl)-1-hydroxy-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 102406003 |
| Molecular Formula | C18H24O7S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (1R,5R,7R,8R)-3-(benzenesulfinyl)-1-hydroxy-7,8-dimethoxy-7,8-dimethyl-6,9-dioxaspiro[4.5]decan-4-one |
| SMILES | CO[C@]1(C)OC[C@]2(O[C@@]1(C)OC)C(=O)C(S(=O)c1ccccc1)C[C@H]2O |
| InChI | InChI=1S/C18H24O7S/c1-16(22-3)17(2,23-4)25-18(11-24-16)14(19)10-13(15(18)20)26(21)12-8-6-5-7-9-12/h5-9,13-14,19H,10-11H2,1-4H3/t13?,14-,16-,17-,18-,26?/m1/s1 |
| InChIKey | CJELXFIZWLGEKL-IASWERQJSA-N |
| XLogP | 1.01 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |