C39H20F6N2S2 — CID 102406616
4-[2-[8,8,9,9,10,10-hexafluoro-4,14-diphenyl-2-(2-pyridin-4-ylethynyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-1-yl]ethynyl]pyridine (PubChem CID 102406616) has the molecular formula C39H20F6N2S2 and a molecular weight of 694.73 g/mol. Its IUPAC name is 4-[2-[8,8,9,9,10,10-hexafluoro-4,14-diphenyl-2-(2-pyridin-4-ylethynyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-1-yl]ethynyl]pyridine.
| Compound Name | 4-[2-[8,8,9,9,10,10-hexafluoro-4,14-diphenyl-2-(2-pyridin-4-ylethynyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-1-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 102406616 |
| Molecular Formula | C39H20F6N2S2 |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 694.10 |
| IUPAC Name | 4-[2-[8,8,9,9,10,10-hexafluoro-4,14-diphenyl-2-(2-pyridin-4-ylethynyl)-3,15-dithiatetracyclo[10.3.0.02,6.07,11]pentadeca-4,6,11,13-tetraen-1-yl]ethynyl]pyridine |
| SMILES | FC1(F)C2=C3C=C(c4ccccc4)SC3(C#Cc3ccncc3)C3(C#Cc4ccncc4)SC(c4ccccc4)=CC3=C2C(F)(F)C1(F)F |
| InChI | InChI=1S/C39H20F6N2S2/c40-37(41)33-29-23-31(27-7-3-1-4-8-27)48-35(29,17-11-25-13-19-46-20-14-25)36(18-12-26-15-21-47-22-16-26)30(34(33)38(42,43)39(37,44)45)24-32(49-36)28-9-5-2-6-10-28/h1-10,13-16,19-24H |
| InChIKey | KXBTUCFPBJKKNA-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|