C39H20F6N2S2 — CID 102089211
4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-pyridin-4-ylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]pyridine (PubChem CID 102089211) has the molecular formula C39H20F6N2S2 and a molecular weight of 694.73 g/mol. Its IUPAC name is 4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-pyridin-4-ylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]pyridine.
| Compound Name | 4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-pyridin-4-ylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 102089211 |
| Molecular Formula | C39H20F6N2S2 |
| Molecular Weight | 694.73 g/mol |
| Exact Mass | 694.10 |
| IUPAC Name | 4-[2-[3-[3,3,4,4,5,5-hexafluoro-2-[5-phenyl-2-(2-pyridin-4-ylethynyl)thiophen-3-yl]cyclopenten-1-yl]-5-phenylthiophen-2-yl]ethynyl]pyridine |
| SMILES | FC1(F)C(c2cc(-c3ccccc3)sc2C#Cc2ccncc2)=C(c2cc(-c3ccccc3)sc2C#Cc2ccncc2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C39H20F6N2S2/c40-37(41)35(29-23-33(27-7-3-1-4-8-27)48-31(29)13-11-25-15-19-46-20-16-25)36(38(42,43)39(37,44)45)30-24-34(28-9-5-2-6-10-28)49-32(30)14-12-26-17-21-47-22-18-26/h1-10,15-24H |
| InChIKey | OBLUMHZFNNNUAN-UHFFFAOYSA-N |
| XLogP | 10.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.73 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|