C34H27IN2S2 — CID 162671326
4-[5-[5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]thiophen-2-yl]thiophen-2-yl]-N,N-diphenylaniline iodide (PubChem CID 162671326) has the molecular formula C34H27IN2S2 and a molecular weight of 654.64 g/mol. Its IUPAC name is 4-[5-[5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]thiophen-2-yl]thiophen-2-yl]-N,N-diphenylaniline iodide.
| Compound Name | 4-[5-[5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]thiophen-2-yl]thiophen-2-yl]-N,N-diphenylaniline iodide |
|---|---|
| PubChem CID | 162671326 |
| Molecular Formula | C34H27IN2S2 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.07 |
| IUPAC Name | 4-[5-[5-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]thiophen-2-yl]thiophen-2-yl]-N,N-diphenylaniline iodide |
| SMILES | C[n+]1ccc(/C=C/c2ccc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)s3)s2)cc1.[I-] |
| InChI | InChI=1S/C34H27N2S2.HI/c1-35-24-22-26(23-25-35)12-17-31-18-19-33(37-31)34-21-20-32(38-34)27-13-15-30(16-14-27)36(28-8-4-2-5-9-28)29-10-6-3-7-11-29;/h2-25H,1H3;1H/q+1;/p-1 |
| InChIKey | SQIPTHIGDLTVEA-UHFFFAOYSA-M |
| XLogP | 6.61 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|