C21H24N2S — CID 11508317
2-[(1R)-1-[2-(2-pyrrolidin-1-ylethyl)-1-benzothiophen-3-yl]ethyl]pyridine (PubChem CID 11508317) has the molecular formula C21H24N2S and a molecular weight of 336.50 g/mol. Its IUPAC name is 2-[(1R)-1-[2-(2-pyrrolidin-1-ylethyl)-1-benzothiophen-3-yl]ethyl]pyridine.
| Compound Name | 2-[(1R)-1-[2-(2-pyrrolidin-1-ylethyl)-1-benzothiophen-3-yl]ethyl]pyridine |
|---|---|
| PubChem CID | 11508317 |
| Molecular Formula | C21H24N2S |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[(1R)-1-[2-(2-pyrrolidin-1-ylethyl)-1-benzothiophen-3-yl]ethyl]pyridine |
| SMILES | C[C@@H](c1ccccn1)c1c(CCN2CCCC2)sc2ccccc12 |
| InChI | InChI=1S/C21H24N2S/c1-16(18-9-4-5-12-22-18)21-17-8-2-3-10-19(17)24-20(21)11-15-23-13-6-7-14-23/h2-5,8-10,12,16H,6-7,11,13-15H2,1H3/t16-/m0/s1 |
| InChIKey | GDVOQNXWYQVYJH-INIZCTEOSA-N |
| XLogP | 5.09 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |