C18H11ClO4 — CID 102407236
3-chloro-8-methoxy-2-phenylfuro[3,2-c]chromen-4-one (PubChem CID 102407236) has the molecular formula C18H11ClO4 and a molecular weight of 326.74 g/mol. Its IUPAC name is 3-chloro-8-methoxy-2-phenylfuro[3,2-c]chromen-4-one.
| Compound Name | 3-chloro-8-methoxy-2-phenylfuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 102407236 |
| Molecular Formula | C18H11ClO4 |
| Molecular Weight | 326.74 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-chloro-8-methoxy-2-phenylfuro[3,2-c]chromen-4-one |
| SMILES | COc1ccc2oc(=O)c3c(Cl)c(-c4ccccc4)oc3c2c1 |
| InChI | InChI=1S/C18H11ClO4/c1-21-11-7-8-13-12(9-11)17-14(18(20)22-13)15(19)16(23-17)10-5-3-2-4-6-10/h2-9H,1H3 |
| InChIKey | YVFFSQNALNEZMG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.74 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|