C50H54F6N2O4 — CID 102407985
dioctyl 2,5-bis[4-[4-(trifluoromethyl)phenyl]anilino]benzene-1,4-dicarboxylate (PubChem CID 102407985) has the molecular formula C50H54F6N2O4 and a molecular weight of 860.98 g/mol. Its IUPAC name is dioctyl 2,5-bis[4-[4-(trifluoromethyl)phenyl]anilino]benzene-1,4-dicarboxylate.
| Compound Name | dioctyl 2,5-bis[4-[4-(trifluoromethyl)phenyl]anilino]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102407985 |
| Molecular Formula | C50H54F6N2O4 |
| Molecular Weight | 860.98 g/mol |
| Exact Mass | 860.40 |
| IUPAC Name | dioctyl 2,5-bis[4-[4-(trifluoromethyl)phenyl]anilino]benzene-1,4-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1cc(Nc2ccc(-c3ccc(C(F)(F)F)cc3)cc2)c(C(=O)OCCCCCCCC)cc1Nc1ccc(-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C50H54F6N2O4/c1-3-5-7-9-11-13-31-61-47(59)43-33-46(58-42-29-21-38(22-30-42)36-17-25-40(26-18-36)50(54,55)56)44(48(60)62-32-14-12-10-8-6-4-2)34-45(43)57-41-27-19-37(20-28-41)35-15-23-39(24-16-35)49(51,52)53/h15-30,33-34,57-58H,3-14,31-32H2,1-2H3 |
| InChIKey | KNQDTKAPCIFSHT-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.98 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|