C15H29NOS4 — CID 102408329
N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]prop-2-enamide (PubChem CID 102408329) has the molecular formula C15H29NOS4 and a molecular weight of 367.67 g/mol. Its IUPAC name is N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]prop-2-enamide.
| Compound Name | N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 102408329 |
| Molecular Formula | C15H29NOS4 |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N,N-bis[2-(2-ethylsulfanylethylsulfanyl)ethyl]prop-2-enamide |
| SMILES | C=CC(=O)N(CCSCCSCC)CCSCCSCC |
| InChI | InChI=1S/C15H29NOS4/c1-4-15(17)16(7-9-20-13-11-18-5-2)8-10-21-14-12-19-6-3/h4H,1,5-14H2,2-3H3 |
| InChIKey | VJVBSCHRSZWABM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|